CymitQuimica logo

CAS 1001518-79-1

:

4-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid hydrazide

Description:
4-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid hydrazide is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro group and a trifluoromethyl group enhances its reactivity and lipophilicity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The hydrazide functional group contributes to its potential as a bioactive molecule, as hydrazides are often involved in the synthesis of various biologically active compounds. This compound may exhibit properties such as antimicrobial or antifungal activity, although specific biological activities would depend on further empirical studies. Its molecular structure suggests it could participate in hydrogen bonding due to the carboxylic acid moiety, influencing its solubility and interaction with biological targets. Overall, this compound represents a unique combination of functional groups that may be explored for diverse applications in medicinal chemistry and material science.
Formula:C6H6ClF3N4O
InChI:InChI=1S/C6H6ClF3N4O/c1-14-3(5(15)12-11)2(7)4(13-14)6(8,9)10/h11H2,1H3,(H,12,15)
InChI key:InChIKey=KWXMTAUVLDBHSW-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=C(Cl)C(C(F)(F)F)=NN1C
Synonyms:
  • 4-Chloro-1-methyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic acid hydrazide
  • 1H-Pyrazole-5-carboxylic acid, 4-chloro-1-methyl-3-(trifluoromethyl)-, hydrazide
Found 1 products.