CymitQuimica logo

CAS 1001518-82-6

:

3-(Difluoromethyl)-5-methyl-1H-pyrazole-1-acetic acid hydrazide

Description:
3-(Difluoromethyl)-5-methyl-1H-pyrazole-1-acetic acid hydrazide, identified by its CAS number 1001518-82-6, is a chemical compound that features a pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This substance is characterized by the presence of a difluoromethyl group, which enhances its reactivity and potential biological activity. The hydrazide functional group contributes to its ability to form hydrogen bonds, influencing its solubility and interaction with biological targets. Typically, compounds of this nature are studied for their potential pharmacological properties, including anti-inflammatory or antimicrobial activities. The presence of both the difluoromethyl and hydrazide moieties suggests that this compound may exhibit unique chemical behavior, making it of interest in medicinal chemistry and drug development. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the electronic effects of the difluoromethyl group and the overall molecular structure.
Formula:C7H10F2N4O
InChI:InChI=1S/C7H10F2N4O/c1-4-2-5(7(8)9)12-13(4)3-6(14)11-10/h2,7H,3,10H2,1H3,(H,11,14)
InChI key:InChIKey=WTZOYIHSKBKRDJ-UHFFFAOYSA-N
SMILES:C(C(NN)=O)N1C(C)=CC(C(F)F)=N1
Synonyms:
  • 1H-Pyrazole-1-acetic acid, 3-(difluoromethyl)-5-methyl-, hydrazide
  • 3-(Difluoromethyl)-5-methyl-1H-pyrazole-1-acetic acid hydrazide
  • 2-[3-(Difluoromethyl)-5-methyl-1H-pyrazol-1-yl]acetohydrazide
Found 2 products.