CymitQuimica logo

CAS 1001519-13-6

:

1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide

Description:
1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted with an ethyl group and a trifluoromethyl group, as well as a hydrazide functional group. This compound is typically a solid at room temperature and is soluble in polar organic solvents. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The hydrazide moiety can participate in various chemical reactions, including hydrazone formation and potential applications in the synthesis of more complex molecules. Additionally, the compound may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, which are common in pyrazole derivatives. Its specific reactivity and stability can be influenced by the surrounding functional groups and the overall molecular environment. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.
Formula:C7H9F3N4O
InChI:InChI=1S/C7H9F3N4O/c1-2-14-5(7(8,9)10)3-4(13-14)6(15)12-11/h3H,2,11H2,1H3,(H,12,15)
InChI key:InChIKey=BBAMKVBADJTXGU-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N(CC)N=C(C(NN)=O)C1
Synonyms:
  • 1-Ethyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide
  • 1H-Pyrazole-3-carboxylic acid, 1-ethyl-5-(trifluoromethyl)-, hydrazide
Found 2 products.