CymitQuimica logo

CAS 1001519-40-9

:

1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide

Description:
1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its unique structural features, including a pyrazole ring, a trifluoromethyl group, and a hydrazide functional group. The presence of the trifluoromethyl group imparts significant lipophilicity and can influence the compound's reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid and hydrazide functionalities. Its hydrazide group can participate in various chemical reactions, making it a potential candidate for further derivatization or as an intermediate in organic synthesis. Additionally, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The stability and reactivity of 1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application.
Formula:C6H7F3N4O
InChI:InChI=1S/C6H7F3N4O/c1-13-4(6(7,8)9)2-3(12-13)5(14)11-10/h2H,10H2,1H3,(H,11,14)
InChI key:InChIKey=JEMCLXOSBQIDKX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C(NN)=O)=NN1C
Synonyms:
  • 1-Methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide
  • 1H-Pyrazole-3-carboxylic acid, 1-methyl-5-(trifluoromethyl)-, hydrazide
Found 3 products.