CymitQuimica logo

CAS 1001519-41-0

:

4-Bromo-1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide

Description:
4-Bromo-1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom and a trifluoromethyl group enhances its reactivity and lipophilicity, making it of interest in various chemical applications. The carboxylic acid hydrazide functional group contributes to its potential as a bioactive molecule, possibly exhibiting antimicrobial or antifungal properties. This compound is typically synthesized through multi-step organic reactions, involving the introduction of the bromine and trifluoromethyl groups onto the pyrazole ring. Its solubility may vary depending on the solvent, and it is likely to be stable under standard laboratory conditions. The compound's unique structure suggests potential utility in medicinal chemistry, particularly in the development of new pharmaceuticals. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.
Formula:C6H6BrF3N4O
InChI:InChI=1S/C6H6BrF3N4O/c1-14-4(6(8,9)10)2(7)3(13-14)5(15)12-11/h11H2,1H3,(H,12,15)
InChI key:InChIKey=BPSXQIKGHPFXQR-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Br)C(C(NN)=O)=NN1C
Synonyms:
  • 4-Bromo-1-methyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid hydrazide
  • 1H-Pyrazole-3-carboxylic acid, 4-bromo-1-methyl-5-(trifluoromethyl)-, hydrazide
Found 1 products.