CymitQuimica logo

CAS 100155-73-5

:

2-Pyridinemethanamine,alpha-ethyl-(9CI)

Description:
2-Pyridinemethanamine, alpha-ethyl- (9CI), with the CAS number 100155-73-5, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl group attached to the alpha position of the methanamine side chain, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both amine and aromatic functionalities suggests that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Additionally, its structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The compound's solubility in polar solvents and its reactivity with electrophiles are notable characteristics that may influence its behavior in different chemical environments. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H12N2
InChI:InChI=1/C8H12N2/c1-2-7(9)8-5-3-4-6-10-8/h3-7H,2,9H2,1H3
InChI key:ARIBPNACTHQUIK-UHFFFAOYSA-N
SMILES:CCC(c1ccccn1)N
Synonyms:
  • 1-Pyridin-2-Ylpropan-1-Amine
Found 4 products.