CAS 1001611-12-6
:4-Chloro-1-ethyl-1H-pyrazole-3-methanamine
Description:
4-Chloro-1-ethyl-1H-pyrazole-3-methanamine is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a chloro group at the 4-position and an ethyl group at the 1-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methanamine functional group at the 3-position enhances its nucleophilicity, making it a candidate for further chemical modifications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions of the environment. As with many nitrogen-containing heterocycles, it may also display biological activity, which warrants further investigation for potential therapeutic uses. Safety data should be consulted to understand its handling and toxicity profiles.
Formula:C6H10ClN3
InChI:InChI=1S/C6H10ClN3/c1-2-10-4-5(7)6(3-8)9-10/h4H,2-3,8H2,1H3
InChI key:InChIKey=MEZJZDGZPVYJTM-UHFFFAOYSA-N
SMILES:C(N)C=1C(Cl)=CN(CC)N1
Synonyms:- (4-Chloro-1-ethylpyrazol-3-yl)methanamine
- 4-Chloro-1-ethyl-1H-pyrazole-3-methanamine
- 1H-Pyrazole-3-methanamine, 4-chloro-1-ethyl-
- (4-Chloro-1-ethyl-1H-pyrazol-3-yl)methanamine
Sort by
Found 1 products.
