CAS 100163-16-4
:hypecoumine
Description:
Hypecoumine, with the CAS number 100163-16-4, is a chemical compound that belongs to the class of coumarins, which are known for their diverse biological activities. This substance typically exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and potential anticoagulant effects. Hypecoumine is characterized by its unique molecular structure, which includes a fused benzopyran ring system, contributing to its reactivity and interaction with biological targets. It is often studied for its potential therapeutic applications, particularly in the fields of medicine and pharmacology. The compound may also demonstrate varying solubility in different solvents, influencing its bioavailability and efficacy. As with many coumarin derivatives, hypecoumine's safety profile and toxicity are important considerations in its application, necessitating thorough research and evaluation in preclinical and clinical studies. Overall, hypecoumine represents a significant area of interest in medicinal chemistry due to its potential benefits and applications in health sciences.
Formula:C19H11NO6
InChI:InChI=1/C19H11NO6/c21-19-15-10(1-2-12-18(15)25-8-22-12)17(26-19)16-11-6-14-13(23-7-24-14)5-9(11)3-4-20-16/h1-6,17H,7-8H2
SMILES:c1cc2c(c3c1C(c1c4cc5c(cc4ccn1)OCO5)OC3=O)OCO2
Synonyms:- Furo(3,4-e)-1,3-benzodioxol-8(6H)-one, 6-(1,3-dioxolo(4,5-g)isoquinolin-5-yl)-, (+)-
- 6-([1,3]dioxolo[4,5-g]isoquinolin-5-yl)furo[3,4-e][1,3]benzodioxol-8(6H)-one
- Hypecoumine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Decumbenine C
CAS:Decumbenine C is a naturally occurring alkaloid, which is a compound primarily sourced from the plant species within the family Menispermaceae. It is characterized by its intricate molecular structure, typical of plant-derived alkaloids, which are known for their diverse pharmacological activities. The mode of action of Decumbenine C is hypothesized to involve modulation of neural pathways, possibly acting on neurotransmitter systems, though precise mechanisms remain under investigation.Formula:C19H11NO6Purity:Min. 95%Molecular weight:349.3 g/mol
