CymitQuimica logo

CAS 1001756-23-5

:

Methyl 7-broMoquinoline-3-carboxylate

Description:
Methyl 7-bromoquinoline-3-carboxylate is an organic compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of a bromine atom at the 7-position and a carboxylate group at the 3-position contributes to its unique chemical properties. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The methyl ester functional group enhances its solubility in organic solvents, making it useful in various synthetic reactions. Additionally, the compound may exhibit interesting optical and electronic properties, which can be explored in materials science. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, Methyl 7-bromoquinoline-3-carboxylate is a versatile compound with significant implications in research and industry.
Formula:C11H8BrNO2
InChI:InChI=1S/C11H8BrNO2/c1-15-11(14)8-4-7-2-3-9(12)5-10(7)13-6-8/h2-6H,1H3
InChI key:GPLUSJRHUJLUHU-UHFFFAOYSA-N
SMILES:COC(=O)C1=CN=C2C=C(C=CC2=C1)Br
Synonyms:
  • Methyl 7-broMoquinoline-3-carboxylate
  • 7-bromoquinoline-3-carboxymethyl
  • 3-Quinolinecarboxylic acid, 7-bromo-, methyl ester
Found 4 products.