CAS 1001757-43-2

3-[(4-Chloro-3-nitro-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide

Description:

3-[(4-Chloro-3-nitro-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety linked to a hydrazide functional group and a pyrazole derivative. The presence of a chloro and nitro group on the pyrazole ring contributes to its potential reactivity and biological activity. This compound is likely to exhibit properties typical of hydrazides, such as the ability to form hydrazones and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests it may participate in hydrogen bonding due to the carboxylic acid and hydrazide functionalities, influencing its solubility and interaction with biological targets. Additionally, the presence of halogen and nitro substituents may enhance its lipophilicity and alter its pharmacokinetic properties. Overall, this compound's unique characteristics make it a subject of interest in various fields, including organic synthesis and drug development.

Formula: C₁₁H₁₀ClN₅O₃

InChI: InChI=1S/C11H10ClN5O3/c12-9-6-16(15-10(9)17(19)20)5-7-2-1-3-8(4-7)11(18)14-13/h1-4,6H,5,13H2,(H,14,18)

InChI key: InChIKey=UCZXPAKFPHEYOQ-UHFFFAOYSA-N

SMILES: C(N1N=C(N(=O)=O)C(Cl)=C1)C2=CC(C(NN)=O)=CC=C2

Synonyms:

• 3-[(4-Chloro-3-nitro-1H-pyrazol-1-yl)methyl]benzoic acid hydrazide
• Benzoic acid, 3-[(4-chloro-3-nitro-1H-pyrazol-1-yl)methyl]-, hydrazide