CAS 10018-19-6
:1,3-Dioxolo[4,5-g]isoquinolinium, 7,8-dihydro-4-methoxy-6-methyl-, chloride (1:1)
Description:
1,3-Dioxolo[4,5-g]isoquinolinium, 7,8-dihydro-4-methoxy-6-methyl-, chloride (1:1), with CAS number 10018-19-6, is a chemical compound characterized by its unique bicyclic structure that incorporates both isoquinoline and dioxole moieties. This compound typically exhibits properties associated with quaternary ammonium salts, including solubility in polar solvents and potential ionic characteristics due to the presence of the chloride ion. The methoxy and methyl substituents contribute to its hydrophobic nature, influencing its reactivity and interaction with biological systems. The compound may display biological activity, making it of interest in medicinal chemistry and pharmacology. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of the dioxole ring may impart unique electronic properties, affecting its stability and reactivity. Overall, this compound represents a fascinating intersection of organic chemistry and pharmacological potential, warranting further investigation into its properties and applications.
Formula:C12H14NO3·Cl
InChI:InChI=1S/C12H14NO3.ClH/c1-13-4-3-8-5-10-12(16-7-15-10)11(14-2)9(8)6-13;/h5-6H,3-4,7H2,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=BWQAGVANIBSWBW-UHFFFAOYSA-M
SMILES:O(C)C=1C2=C(C=C3C1OCO3)CC[N+](C)=C2.[Cl-]
Synonyms:- 1,3-Dioxolo(4,5-g)isoquinolinium, 7,8-dihydro-4-methoxy-6-methyl-, chloride (8CI)(9CI)
- 1,3-Dioxolo[4,5-g]isoquinolinium, 7,8-dihydro-4-methoxy-6-methyl-, chloride
- 1,3-Dioxolo[4,5-g]isoquinolinium, 7,8-dihydro-4-methoxy-6-methyl-, chloride (1:1)
- 4-Methoxy-6-Methyl-7,8-Dihydro[1,3]Dioxolo[4,5-G]Isoquinolin-6-Ium
- 4-Methoxy-6-Methyl-7,8-Dihydro[1,3]Dioxolo[4,5-G]Isoquinolin-6-Ium Chloride
- 7,8-Dihydro-4-methoxy-6-methyl-1,3-dioxolo(4,5-g)isoquinolinium chloride
- Cotarninium chloratum
- Cotarninium chloride
- Kotarninchlorid
- Nsc 24824
- Stypticin
- Unii-03F6B8N3Qn
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Cotarnine chloride
CAS:Cotarnine chlorideFormula:C12H14NO3·ClPurity:≥95%Color and Shape:SolidMolecular weight:255.69746Cotarnine Chloride
CAS:Controlled ProductStability Hygroscopic
Applications Cotarnine Chloride is an oxidative degradation product of the drug Noscapine.
References Johansson, M., et al.: J. Pharm. Biomed. Anal., 7, 1055 (1989), Ukhin, L., et al.: Chem. Nat. Compds., 40, 156 (2004),Formula:C12H14NO3·ClColor and Shape:NeatMolecular weight:255.7Cotarnine chloride
CAS:Cotarnine chloride is an isoquinoline alkaloid, which is a derivative of the opium alkaloid narcotine. It is synthesized through the oxidation and chlorination of narcotine extracted from opium. The mode of action of cotarnine chloride primarily involves its vasoconstrictive properties, which help in reducing blood flow by contracting smooth muscle fibers in blood vessels. This action aids in achieving hemostasis, thereby preventing or controlling hemorrhage.Formula:C12H14ClNO3Purity:Min. 95%Color and Shape:Off-White To Yellow SolidMolecular weight:255.7 g/mol





