CAS 100188-44-1

(S)-4-Oxo-2-azetidinecarboxylicacidmethylester

Description:

(S)-4-Oxo-2-azetidinecarboxylic acid methyl ester, identified by its CAS number 100188-44-1, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a ketone functional group (4-oxo) and a carboxylic acid moiety that is esterified with methanol, resulting in the methyl ester form. The presence of the chiral center at the azetidine ring contributes to its stereochemistry, specifically the (S) configuration, which can influence its biological activity and interactions. This compound is of interest in medicinal chemistry and organic synthesis due to its potential applications in drug development and as an intermediate in the synthesis of more complex molecules. Its properties, such as solubility, reactivity, and stability, can vary based on the specific conditions and environment in which it is used. Overall, (S)-4-Oxo-2-azetidinecarboxylic acid methyl ester represents a valuable compound in the field of organic and pharmaceutical chemistry.

Formula: C5H7NO3

InChI: InChI=1S/C5H7NO3/c1-9-5(8)3-2-4(7)6-3/h3H,2H2,1H3,(H,6,7)

InChI key: WAKVYXZJTFOVKC-UHFFFAOYSA-N

SMILES: COC(=O)C1CC(=O)N1

(S)-Methyl 4-oxoazetidine-2-carboxylate

CAS: 100188-44-1

Formula: C₅H₇NO₃

Molecular weight: 129.1140

Ref: IN-DA00015X

(S)-Methyl 4-oxoazetidine-2-carboxylate

CAS: 100188-44-1

(S)-Methyl 4-oxoazetidine-2-carboxylate is a chemical compound that is used as an experimental reactant. It has been shown to be reactive with nucleophiles and undergoes attack by nucleophilic reagents, such as amines and alcohols. The compound also reacts with dipolar reagents to produce the corresponding product in high yield. This reactivity is due to the planar nature of the molecule, which enables it to form strong hydrogen bonds and electrostatic interactions with other molecules. (S)-Methyl 4-oxoazetidine-2-carboxylate is soluble in solvents such as ether, dichloromethane, benzene, and acetone.

Formula: C₅H₇NO₃

Purity: Min. 95%

Molecular weight: 129.11 g/mol

Ref: 3D-AEA18844