CymitQuimica logo

CAS 100189-84-2

:

2,5-Dibromo-M-Xylene

Description:
2,5-Dibromo-m-xylene, with the CAS number 100189-84-2, is an aromatic compound characterized by the presence of two bromine atoms and a dimethyl substitution on a benzene ring. Specifically, it features bromine substituents at the 2 and 5 positions relative to the methyl groups located at the 1 and 4 positions of the benzene ring, making it a derivative of m-xylene. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for brominated aromatic compounds. The presence of bromine atoms enhances its reactivity, making it useful in various chemical syntheses, including the production of pharmaceuticals and agrochemicals. Additionally, 2,5-Dibromo-m-xylene may exhibit biological activity, which can be of interest in medicinal chemistry. As with many brominated compounds, it is important to handle it with care due to potential environmental and health impacts.
Formula:C8H8Br2
InChI:InChI=1S/C8H8Br2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3
InChI key:XXFGKGMZLZIPCN-UHFFFAOYSA-N
SMILES:CC1=CC(=CC(=C1Br)C)Br
Synonyms:
  • 1,4-Dibromo-2,6-Dimethylbenzene
Found 4 products.