CymitQuimica logo

CAS 1001907-44-3

:

tert-butyl 3-(hydrazinecarbonyl)azetidine-1-carboxylate

Description:
Tert-butyl 3-(hydrazinecarbonyl)azetidine-1-carboxylate is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a tert-butyl group, contributing to its hydrophobic properties, and a hydrazinecarbonyl moiety, which introduces reactivity due to the presence of the hydrazine functional group. The carboxylate group enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification or amidation. The presence of the hydrazine group suggests potential applications in medicinal chemistry, particularly in the synthesis of bioactive compounds or as intermediates in drug development. Additionally, the compound may exhibit interesting biological activities, making it a candidate for further research in pharmacology. Its stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in its handling and application in laboratory settings. Overall, tert-butyl 3-(hydrazinecarbonyl)azetidine-1-carboxylate is a versatile compound with potential utility in various chemical and pharmaceutical contexts.
Formula:C9H17N3O3
InChI:InChI=1S/C9H17N3O3/c1-9(2,3)15-8(14)12-4-6(5-12)7(13)11-10/h6H,4-5,10H2,1-3H3,(H,11,13)
InChI key:IOXCKRNGHYJOAQ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC(C1)C(=O)NN
Found 4 products.