CAS 1001907-60-3: B-(1-Methyl-1H-indazol-4-yl)boronic acid
Description:B-(1-Methyl-1H-indazol-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a 1-methyl-1H-indazole moiety. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The indazole ring contributes to its aromatic character and potential biological activity. The compound is often utilized in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. Additionally, its boronic acid functionality allows for potential applications in drug development, particularly in the design of inhibitors targeting specific enzymes or receptors. The stability and reactivity of B-(1-Methyl-1H-indazol-4-yl)boronic acid can be influenced by factors such as pH and the presence of other functional groups, making it a versatile building block in chemical research and development.
Formula:C8H9BN2O2
InChI:InChI=1S/C8H9BN2O2/c1-11-8-4-2-3-7(9(12)13)6(8)5-10-11/h2-5,12-13H,1H3
InChI key:InChIKey=MDEHELJMJCXYIU-UHFFFAOYSA-N
SMILES:OB(O)C1=CC=CC2=C1C=NN2C
- Synonyms:
- 1-Methylindazole-4-boronic acid
- Boronic acid, B-(1-methyl-1H-indazol-4-yl)-
- (1-Methyl-1H-indazol-4-yl)boronic acid
- B-(1-Methyl-1H-indazol-4-yl)boronic acid
- (1-Methylindazol-4-yl)boronic acid

Boronic acid, B-(1-methyl-1H-indazol-4-yl)-
Ref: IN-DA00016I
1g | 68.00 € | ||
5g | 152.00 € | ||
10g | 300.00 € | ||
100mg | 48.00 € | ||
250mg | 53.00 € |

1-Methyl-1H-indazole-4-boronic acid
Ref: 54-OR60109
1g | 99.00 € | ||
5g | 300.00 € | ||
250mg | 67.00 € |

(1-Methyl-1H-indazol-4-yl)boronic acid
Ref: 10-F237003
1g | 47.00 € | ||
5g | 175.00 € | ||
10g | 321.00 € | ||
250mg | 34.00 € |

Ref: FT-M11226
1g | To inquire | ||
5g | To inquire |

1-Methylindazole-4-boronic acid
Ref: 3D-FM53520
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |