CymitQuimica logo

CAS 1001907-64-7

:

5,8-Dioxaspiro[3.4]octane-2-carboxylic acid

Description:
5,8-Dioxaspiro[3.4]octane-2-carboxylic acid is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework with two ether linkages and a carboxylic acid functional group. This compound belongs to a class of spiro compounds, which are known for their distinctive three-dimensional arrangements that can influence their reactivity and interactions. The presence of the dioxaspiro moiety contributes to its potential applications in organic synthesis and medicinal chemistry, as such structures can exhibit interesting biological activities. The carboxylic acid group enhances its solubility in polar solvents and allows for potential derivatization reactions. Additionally, the compound may exhibit specific stereochemical properties due to its spiro configuration, which can affect its behavior in various chemical environments. Overall, 5,8-Dioxaspiro[3.4]octane-2-carboxylic acid is a compound of interest for researchers exploring novel organic materials and pharmaceuticals.
Formula:C7H10O4
InChI:InChI=1S/C7H10O4/c8-6(9)5-3-7(4-5)10-1-2-11-7/h5H,1-4H2,(H,8,9)
InChI key:InChIKey=PGWGOPXPTJDZKT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CC2(C1)OCCO2
Synonyms:
  • 5,8-Dioxaspiro[3.4]octane-2-carboxylic acid
Found 5 products.