CymitQuimica logo

CAS 1001907-67-0

:

B-(4-Ethyl-3-pyridinyl)boronic acid

Description:
B-(4-Ethyl-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring with an ethyl substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar organic solvents, and possessing acidic characteristics due to the boronic acid moiety. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry and its role in biological systems. Additionally, this compound may exhibit interesting electronic properties due to the conjugation between the boron and the nitrogen in the pyridine ring. Overall, B-(4-Ethyl-3-pyridinyl)boronic acid is a versatile compound with applications in drug development and materials science.
Formula:C7H10BNO2
InChI:InChI=1S/C7H10BNO2/c1-2-6-3-4-9-5-7(6)8(10)11/h3-5,10-11H,2H2,1H3
InChI key:InChIKey=SXRPBNQECJWOON-UHFFFAOYSA-N
SMILES:C(C)C=1C(B(O)O)=CN=CC1
Synonyms:
  • B-(4-Ethyl-3-pyridinyl)boronic acid
  • Boronic acid, B-(4-ethyl-3-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.