CymitQuimica logo

CAS 1001907-69-2

:

6-Ethylpyridine-3-boronic acid

Description:
6-Ethylpyridine-3-boronic acid is an organoboron compound characterized by the presence of a pyridine ring substituted with an ethyl group and a boronic acid functional group. The molecular structure features a six-membered aromatic ring containing nitrogen, which contributes to its basicity and potential for coordination with metal ions. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols. Its reactivity is influenced by the boron atom, which can participate in cross-coupling reactions, a key feature in the development of pharmaceuticals and agrochemicals. Additionally, the ethyl substituent can affect the compound's lipophilicity and overall biological activity. Safety data should be consulted for handling, as boronic acids can be sensitive to moisture and may require specific storage conditions.
Formula:C7H10BNO2
InChI:InChI=1S/C7H10BNO2/c1-2-7-4-3-6(5-9-7)8(10)11/h3-5,10-11H,2H2,1H3
InChI key:LPXSVMTZVQACFE-UHFFFAOYSA-N
SMILES:CCc1ccc(cn1)B(O)O
Found 3 products.