
CAS 1001908-89-9
:SRT2183
Description:
SRT2183, with the CAS number 1001908-89-9, is a chemical compound that has garnered attention primarily for its potential therapeutic applications. It is known as a selective SIRT1 (sirtuin 1) activator, which suggests that it may play a role in regulating cellular processes such as metabolism, aging, and stress responses. SIRT1 is a member of the sirtuin family of proteins, which are involved in deacetylation processes that affect gene expression and cellular function. The activation of SIRT1 by compounds like SRT2183 has been studied for its implications in various health conditions, including metabolic disorders and age-related diseases. In terms of physical properties, specific details such as solubility, melting point, and stability may vary and are typically determined through experimental methods. As research continues, the full spectrum of biological effects and potential therapeutic uses of SRT2183 is still being explored, making it a compound of interest in the fields of biochemistry and pharmacology.
Formula:C27H24N4O2S
InChI:InChI=1S/C27H24N4O2S/c32-22-11-12-30(15-22)14-21-17-34-27-29-25(16-31(21)27)23-7-3-4-8-24(23)28-26(33)20-10-9-18-5-1-2-6-19(18)13-20/h1-10,13,16-17,22,32H,11-12,14-15H2,(H,28,33)/t22-/m1/s1
InChI key:MUFSINOSQBMSLE-JOCHJYFZSA-N
SMILES:C1CN(C[C@@H]1O)CC2=CSC3=NC(=CN23)C4=CC=CC=C4NC(=O)C5=CC6=CC=CC=C6C=C5
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
SRT 2183
CAS:SRT 2183 is a selective activator of Sirtuin-1 (SIRT1, EC1.5 : 0.36 μM).Formula:C27H24N4O2SPurity:97.86%Color and Shape:SolidMolecular weight:468.57Ref: TM-T16932
1mg52.00€2mg69.00€5mg102.00€1mL*10mM (DMSO)105.00€10mg157.00€25mg268.00€50mg408.00€100mg590.00€SRT 2183
CAS:(R)-N-(2-(3-((3-Hydroxypyrrolidin-1-yl)methyl)imidazo[2,1-b]thiazol-6-yl)phenyl)-2-naphthamideFormula:C27H24N4O2SPurity:99%Molecular weight:468.57SRT 2183
CAS:SRT 2183 is an experimental drug that has been shown to have anti-cancer properties. It blocks the transcription of a number of genes that are involved in oxidative injury, cell growth, and inflammation. SRT 2183 activates AMPK by binding to the regulatory subunit known as alpha2. This activation leads to increased autophagy and apoptosis in cancer cells. The drug also works by blocking the production of certain proteins that are involved in metabolic disorders, such as type-2 diabetes mellitus and obesity. SRT 2183 has been shown to be safe for use in clinical trials with people who have cancer or metabolic disorders.
Formula:C27H24N4O2SPurity:Min. 95%Molecular weight:468.57 g/mol




