CymitQuimica logo

CAS 100191-21-7

:

1,5-Dibromo-2,4-dichlorobenzene

Description:
1,5-Dibromo-2,4-dichlorobenzene is an aromatic compound characterized by the presence of bromine and chlorine substituents on a benzene ring. Specifically, it features two bromine atoms located at the 1 and 5 positions, and two chlorine atoms at the 2 and 4 positions of the benzene ring. This compound is typically a solid at room temperature and may exhibit a crystalline structure. It is known for its relatively high stability due to the resonance stabilization of the aromatic system. The presence of halogen atoms contributes to its chemical reactivity, making it useful in various applications, including as an intermediate in organic synthesis and in the production of agrochemicals. Additionally, 1,5-dibromo-2,4-dichlorobenzene may have environmental implications due to its halogenated nature, which can affect its persistence and bioaccumulation in ecosystems. Safety precautions are necessary when handling this compound, as it may pose health risks through inhalation or skin contact.
Formula:C6H2Br2Cl2
InChI:InChI=1S/C6H2Br2Cl2/c7-3-1-4(8)6(10)2-5(3)9/h1-2H
InChI key:InChIKey=AIYBGLGSFXUJDS-UHFFFAOYSA-N
SMILES:BrC1=C(Cl)C=C(Cl)C(Br)=C1
Synonyms:
  • 1,5-Dibromo-2,4-dichlorobenzene
  • Benzene, 1,5-dibromo-2,4-dichloro-
Found 3 products.