CymitQuimica logo

CAS 1001911-63-2

:

(9-phenyl-9H-carbazol-2-yl)boronic acid

Description:
(9-phenyl-9H-carbazol-2-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a carbazole structure, which is a fused ring system containing nitrogen. This compound typically exhibits properties such as good thermal stability and solubility in organic solvents, making it suitable for various applications in organic electronics and materials science. The boronic acid group allows for reversible interactions with diols, which is useful in sensor applications and in the development of boron-containing polymers. Additionally, the phenyl substituent enhances the electronic properties of the carbazole moiety, potentially improving its photophysical characteristics. This compound may also exhibit fluorescence, making it valuable in optoelectronic devices. Its unique structure and functional groups contribute to its reactivity and potential utility in synthetic chemistry, particularly in cross-coupling reactions and as a building block for more complex molecular architectures.
Formula:C18H14BNO2
InChI:InChI=1S/C18H14BNO2/c21-19(22)13-10-11-16-15-8-4-5-9-17(15)20(18(16)12-13)14-6-2-1-3-7-14/h1-12,21-22H
InChI key:XSAOVBUSKVZIBE-UHFFFAOYSA-N
SMILES:B(C1=CC2=C(C=C1)C3=CC=CC=C3N2C4=CC=CC=C4)(O)O
Synonyms:
  • 9-Phenylcarbazole-2-Boronic Acid
  • (9-Phenyl)carbazole-2-boronic acid
  • 9-phenyl-9H-carbazol-2-ylboronic acid
Found 5 products.