CymitQuimica logo

CAS 1002033-65-9

:

Ethyl 4-chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-acetate

Description:
Ethyl 4-chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-acetate is a chemical compound characterized by its unique structural features, which include a pyrazole ring substituted with a chloro group, a cyclopropyl group, and a trifluoromethyl group. This compound is typically classified as a pyrazole derivative, which is known for its diverse biological activities, including potential applications in pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group often enhances lipophilicity and metabolic stability, making such compounds of interest in drug design. Additionally, the ethyl acetate moiety contributes to its solubility properties, which can influence its reactivity and interaction with biological targets. The compound's molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and cycloadditions, which can be exploited in synthetic chemistry. Overall, this compound exemplifies the complexity and versatility of heterocyclic chemistry, with implications in medicinal chemistry and material science.
Formula:C11H12ClF3N2O2
InChI:InChI=1S/C11H12ClF3N2O2/c1-2-19-7(18)5-17-9(6-3-4-6)8(12)10(16-17)11(13,14)15/h6H,2-5H2,1H3
InChI key:InChIKey=DBBUGUWOCNGNQM-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)N1C(=C(Cl)C(C(F)(F)F)=N1)C2CC2
Synonyms:
  • 1H-Pyrazole-1-acetic acid, 4-chloro-5-cyclopropyl-3-(trifluoromethyl)-, ethyl ester
  • Ethyl 4-chloro-5-cyclopropyl-3-(trifluoromethyl)-1H-pyrazole-1-acetate
Found 1 products.