CAS 100208-36-4
:2,4,6,9,12-Pentaoxahexadecan-1-ol
Description:
2,4,6,9,12-Pentaoxahexadecan-1-ol, with the CAS number 100208-36-4, is a polyether compound characterized by a long carbon chain interspersed with multiple ether linkages. This structure contributes to its hydrophilic properties, making it soluble in water and other polar solvents. The presence of hydroxyl (-OH) groups at one end of the molecule enhances its ability to form hydrogen bonds, which can influence its reactivity and interaction with other substances. Typically, compounds like this are used in various applications, including surfactants, emulsifiers, and as intermediates in organic synthesis. The molecular structure suggests that it may exhibit low volatility and a relatively high boiling point, which is common for larger, polar molecules. Additionally, its stability under a range of conditions makes it suitable for use in formulations requiring consistent performance. Overall, 2,4,6,9,12-Pentaoxahexadecan-1-ol is notable for its unique combination of hydrophilicity and structural complexity, making it valuable in both industrial and research settings.
Formula:C11H24O6
InChI:InChI=1S/C11H24O6/c1-2-3-4-13-5-6-14-7-8-15-10-17-11-16-9-12/h12H,2-11H2,1H3
InChI key:InChIKey=GFOGXEVYGYEXEE-UHFFFAOYSA-N
SMILES:C(COCOCOCO)OCCOCCCC
Synonyms:- 2,4,6,9,12-Pentaoxahexadecan-1-ol
Sort by
Found 1 products.
