
CAS 100208-40-0
:2,4,7,10,13-Pentaoxatetradecane-1,14-diol
Description:
2,4,7,10,13-Pentaoxatetradecane-1,14-diol, with the CAS number 100208-40-0, is a polyether compound characterized by its long carbon chain and multiple ether linkages. This substance features a diol functional group, indicating the presence of two hydroxyl (-OH) groups, which contributes to its hydrophilicity and potential solubility in water. The presence of five ether linkages within its structure enhances its flexibility and can influence its physical properties, such as melting and boiling points. Typically, compounds like this are utilized in various applications, including as surfactants, emulsifiers, or in the synthesis of polymers. Its molecular structure suggests that it may exhibit low toxicity and good compatibility with biological systems, making it of interest in pharmaceutical and cosmetic formulations. Additionally, the presence of multiple oxygen atoms can enhance its ability to form hydrogen bonds, which may affect its interactions with other molecules. Overall, 2,4,7,10,13-Pentaoxatetradecane-1,14-diol is a versatile compound with potential applications in diverse fields.
Formula:C9H20O7
InChI:InChI=1S/C9H20O7/c10-7-14-5-3-12-1-2-13-4-6-15-9-16-8-11/h10-11H,1-9H2
InChI key:InChIKey=SAVBORFLETUNGO-UHFFFAOYSA-N
SMILES:C(OCCOCOCO)COCCOCO
Synonyms:- 2,4,7,10,13-Pentaoxatetradecane-1,14-diol
Sort by
Found 1 products.
