
CAS 100231-76-3
:1H-Indenecarboxaldehyde, 2,3,3a,4,5,6-hexahydro-2,2,3a-trimethyl-
Description:
1H-Indenecarboxaldehyde, 2,3,3a,4,5,6-hexahydro-2,2,3a-trimethyl- is an organic compound characterized by its complex bicyclic structure, which includes an indene framework and an aldehyde functional group. This compound features a saturated hexahydro structure, indicating that it has multiple hydrogen atoms and lacks double bonds in the saturated portion of the molecule. The presence of trimethyl groups suggests that it has several methyl substituents, contributing to its overall stability and potentially influencing its reactivity and physical properties. Typically, compounds of this nature may exhibit a range of boiling points and solubility characteristics depending on their molecular structure and functional groups. They may also possess interesting aromatic properties due to the indene component, which can affect their behavior in chemical reactions, such as electrophilic substitutions. Additionally, the compound may find applications in organic synthesis, fragrance formulations, or as an intermediate in the production of other chemical entities. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C13H20O
InChI:InChI=1S/C13H20O/c1-12(2)9-13(3)7-5-4-6-10(13)11(12)8-14/h6,8,11H,4-5,7,9H2,1-3H3
InChI key:GOWIYTQTDKCRDA-UHFFFAOYSA-N
SMILES:CC1(CC2(CCCC=C2C1C=O)C)C
Synonyms:- 3a,4,5,6-Tetrahydro-2,2,3a-trimethylindancarbaldehyde
- 1H-Indenecarboxaldehyde, 2,3,3a,4,5,6-hexahydro-2,2,3a-trimethyl-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1H-Indenecarboxaldehyde, 2,3,3a,4,5,6-hexahydro-2,2,3a-trimethyl- (9CI)
CAS:Formula:C13H20OMolecular weight:192.2973
