
CAS 100231-78-5
:Phosphonium, tetrakis(hydroxymethyl)-, phosphate (2:1) (salt)
Description:
Phosphonium, tetrakis(hydroxymethyl)-, phosphate (2:1) (salt), identified by CAS number 100231-78-5, is a chemical compound characterized by its phosphonium cation and phosphate anion structure. This substance typically features a tetrakis(hydroxymethyl) phosphonium group, which is a quaternary ammonium derivative where four hydroxymethyl groups are attached to a phosphorus atom. The presence of hydroxymethyl groups enhances its solubility in water and may impart certain biological properties. As a salt, it is formed through the neutralization of a phosphonium base with a phosphate acid, resulting in a stable ionic compound. This compound is often utilized in various applications, including as a reagent in organic synthesis, in the formulation of surfactants, and potentially in biological systems due to its phosphonium moiety. Its properties, such as stability, solubility, and reactivity, make it of interest in both industrial and research settings. However, specific safety and handling guidelines should be followed, as with any chemical substance.
Formula:C4H12O4PHO4P
InChI:InChI=1S/C4H12O4P.H3O4P/c5-1-9(2-6,3-7)4-8;1-5(2,3)4/h5-8H,1-4H2;(H3,1,2,3,4)/q+1;/p-2
InChI key:InChIKey=VSILTKFIPVZOAK-UHFFFAOYSA-L
SMILES:[P+](CO)(CO)(CO)CO.P(=O)([O-])([O-])O
Synonyms:- Tetrakis(hydroxymethyl)phosphonium phosphate (2:1)
- Phosphonium, tetrakis(hydroxymethyl)-, phosphate (2:1) (salt)
Sort by
Found 1 products.
Phosphonium, tetrakis(hydroxymethyl)-, phosphate (2:1) (salt) (9CI)
CAS:Formula:C8H25O12P3Molecular weight:406.1982
