CymitQuimica logo

CAS 1002334-13-5

:

1-Phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole

Description:
1-Phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is an organic compound characterized by its unique structural features, which include a pyrazole ring and a boron-containing dioxaborolane moiety. The presence of the phenyl group contributes to its aromatic properties, while the dioxaborolane unit enhances its reactivity, particularly in cross-coupling reactions, making it valuable in synthetic organic chemistry. This compound is typically used in the development of pharmaceuticals and agrochemicals due to its potential biological activity. Its molecular structure suggests it may exhibit interesting electronic properties, which can be exploited in materials science and catalysis. Additionally, the presence of the boron atom can facilitate various chemical transformations, including nucleophilic substitutions and coordination with other ligands. Overall, this compound represents a versatile building block in organic synthesis, with applications that extend to medicinal chemistry and materials development. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C15H19BN2O2
InChI:InChI=1S/C15H19BN2O2/c1-14(2)15(3,4)20-16(19-14)13-10-11-18(17-13)12-8-6-5-7-9-12/h5-11H,1-4H3
InChI key:InChIKey=UBYYGXCGPBWGKO-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=NN(C=C2)C3=CC=CC=C3
Synonyms:
  • 1H-Pyrazole, 1-phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 1-Phenyl-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
  • 1-Phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole
  • 1-Phenyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Found 4 products.