CAS 100234-69-3
:resorcinomycin B
Description:
Resorcinomycin B is a naturally occurring antibiotic compound produced by certain strains of the bacterium *Micromonospora* species. It is characterized by its complex molecular structure, which includes a resorcinol moiety and a unique lactone ring. This compound exhibits notable antibacterial activity, particularly against Gram-positive bacteria, making it of interest in the field of medicinal chemistry and antibiotic research. Resorcinomycin B has been studied for its potential applications in treating bacterial infections, especially those resistant to conventional antibiotics. Its mechanism of action involves interference with bacterial cell wall synthesis, leading to cell lysis. Additionally, the compound has shown promise in various biological assays, indicating potential anti-inflammatory and anticancer properties. However, further research is necessary to fully understand its pharmacological profile, toxicity, and therapeutic potential. As with many natural products, the extraction and synthesis of resorcinomycin B pose challenges, but advancements in synthetic biology and organic synthesis may facilitate its development for clinical use.
Formula:C13H18N4O5
InChI:InChI=1/C13H18N4O5/c1-2-7-8(18)3-6(4-9(7)19)11(17-13(14)15)12(22)16-5-10(20)21/h3-4,11,18-19H,2,5H2,1H3,(H,16,22)(H,20,21)(H4,14,15,17)/t11-/m0/s1
Synonyms:- resorcinomycin B
- Glycine, N-(N-(aminoiminomethyl)-L-2-(4-ethyl-3,5-dihydroxyphenyl)glycyl)-
- N-(alpha-Guanidino-3,5-dihydroxy-4-ethylphenylacetyl)glycine
- N-[(2S)-2-[(diaminomethylidene)amino]-2-(4-ethyl-3,5-dihydroxyphenyl)acetyl]glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Resorcinomycin B
CAS:Resorcinomycin B is an antibiotic found in [Streptoverticillum roseoverticillatum].Formula:C13H18N4O5Color and Shape:SolidMolecular weight:310.306
