CymitQuimica logo

CAS 1002345-50-7

:

dicyclohexyl(3-dicyclohexylphosphanylpropyl)phosphane,ditetrafluoroborate

Description:
Dicyclohexyl(3-dicyclohexylphosphanylpropyl)phosphane, ditetrafluoroborate is a complex organophosphorus compound characterized by its unique phosphane structure, which features multiple cyclohexyl groups and a phosphanylpropyl moiety. This compound typically exhibits a high degree of steric hindrance due to the bulky cyclohexyl substituents, which can influence its reactivity and interactions with other chemical species. The presence of the tetrafluoroborate anion suggests that it may have applications in coordination chemistry and catalysis, as well as in the stabilization of reactive intermediates. Additionally, the compound may display interesting solubility properties, potentially being soluble in organic solvents while being less soluble in polar solvents. Its synthesis likely involves the reaction of phosphines with appropriate electrophiles, and it may be used in various applications, including as a ligand in metal complexes or in organic synthesis. Safety data should be consulted for handling, as organophosphorus compounds can exhibit toxicity depending on their structure and functional groups.
Formula:C27H50B2F8P2
InChI:InChI=1S/C27H50P2.2BF4/c1-5-14-24(15-6-1)28(25-16-7-2-8-17-25)22-13-23-29(26-18-9-3-10-19-26)27-20-11-4-12-21-27;2*2-1(3,4)5/h24-27H,1-23H2;;/q;2*-1/p+2
InChI key:XJZAIJGNZUQTAM-UHFFFAOYSA-P
SMILES:[B-](F)(F)(F)F.[B-](F)(F)(F)F.C1CCC(CC1)[PH+](CCC[PH+](C2CCCCC2)C3CCCCC3)C4CCCCC4
Synonyms:
  • 1,3-Bis(dicyclohexylphosphino)propane bis(tetrafluoroborate)
Found 6 products.