CymitQuimica logo

CAS 1002355-96-5

:

tert-Butyl 3-(2-ethoxy-2-oxoethylidene)azetidine-1-carboxylate

Description:
Tert-Butyl 3-(2-ethoxy-2-oxoethylidene)azetidine-1-carboxylate is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a tert-butyl ester group, contributing to its lipophilicity and potential applications in organic synthesis. The presence of the 2-ethoxy-2-oxoethylidene moiety introduces a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The compound's structure suggests it may exhibit interesting biological activities, making it a candidate for further pharmacological studies. Additionally, its unique functional groups may allow for modifications that enhance its reactivity or selectivity in synthetic pathways. As with many organic compounds, its stability, solubility, and reactivity will depend on the specific conditions under which it is handled, including temperature, solvent choice, and the presence of catalysts or other reagents. Overall, tert-Butyl 3-(2-ethoxy-2-oxoethylidene)azetidine-1-carboxylate represents a versatile building block in organic chemistry.
Formula:C12H19NO4
InChI:InChI=1S/C12H19NO4/c1-5-16-10(14)6-9-7-13(8-9)11(15)17-12(2,3)4/h6H,5,7-8H2,1-4H3
InChI key:WYWJZDFQQJTRDD-UHFFFAOYSA-N
SMILES:CCOC(=O)C=C1CN(C1)C(=O)OC(C)(C)C
Synonyms:
  • Tertbutylethoxyoxoethylideneazetidinecarboxylate
Found 6 products.