CymitQuimica logo

CAS 100240-05-9

:

N-PHENYL-3-PIPERIDINAMINE

Description:
N-Phenyl-3-piperidinamines, identified by the CAS number 100240-05-9, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a phenyl group attached to the nitrogen of the piperidine, contributing to its unique chemical properties. Typically, such compounds exhibit basicity due to the presence of the nitrogen atom, which can accept protons. N-Phenyl-3-piperidinamines may also demonstrate potential biological activity, making them of interest in medicinal chemistry and drug development. The presence of the phenyl group can enhance lipophilicity, influencing the compound's solubility and permeability in biological systems. Additionally, the structural configuration can affect its interaction with biological targets, potentially leading to various pharmacological effects. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and reactivity, can vary based on the purity and specific formulation of the substance. Safety data should be consulted for handling and usage guidelines, as with any chemical compound.
Formula:C11H16N2
InChI:InChI=1/C11H16N2/c1-2-5-10(6-3-1)13-11-7-4-8-12-9-11/h1-3,5-6,11-13H,4,7-9H2
InChI key:JQDNZFYQBNCCRO-UHFFFAOYSA-N
SMILES:c1ccc(cc1)NC1CCCNC1
Synonyms:
  • 3-Phenylaminopiperidine
  • N-phenylpiperidin-3-amine
Found 2 products.