CymitQuimica logo

CAS 100256-89-1

:

3-ETHOXY-2-PROPOXYBENZALDEHYDE

Description:
3-Ethoxy-2-propoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features two ether substituents: an ethoxy group (-OCH2CH3) and a propoxy group (-OCH(CH3)2) attached to the benzene ring. The presence of these alkoxy groups influences its solubility, making it more soluble in organic solvents compared to water. The aldehyde functional group contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. This compound may exhibit interesting properties, including potential applications in organic synthesis, fragrance formulation, or as an intermediate in the production of other chemical compounds. Its molecular structure suggests that it may have moderate volatility and a distinct aromatic odor. Safety data should be consulted for handling and storage, as aldehydes can be irritants and may pose health risks. Overall, 3-ethoxy-2-propoxybenzaldehyde is a versatile compound with potential utility in various chemical applications.
Formula:C12H16O3
InChI:InChI=1/C12H16O3/c1-3-8-15-12-10(9-13)6-5-7-11(12)14-4-2/h5-7,9H,3-4,8H2,1-2H3
InChI key:NGLILBQTESXZCG-UHFFFAOYSA-N
SMILES:CCCOc1c(cccc1OCC)C=O
Found 2 products.