CAS 1002726-62-6

6-amino-2,2-dimethyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

Description:

6-Amino-2,2-dimethyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyridine and an oxazine moiety. This compound features an amino group at the 6-position and two methyl groups at the 2-position of the pyridine ring, contributing to its unique chemical properties. The presence of the oxazine ring enhances its potential for various chemical reactions, making it of interest in medicinal chemistry and drug development. The compound is likely to exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its structural features may also influence its biological activity, potentially allowing it to interact with specific biological targets. As with many heterocycles, it may exhibit interesting pharmacological properties, although specific biological data would be necessary to fully understand its applications. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₉H₁₁N₃O₂

InChI: InChI=1S/C9H11N3O2/c1-9(2)8(13)12-7-5(14-9)3-4-6(10)11-7/h3-4H,1-2H3,(H3,10,11,12,13)

SMILES: CC1(C)C(=Nc2c(ccc(=N)[nH]2)O1)O

Synonyms:

• 6-amino-2,2-dimethyl-2H,3H,4H-pyrido[3,2-b][1,4]oxazin-3-one

2H-Pyrido[3,2-b]-1,4-oxazin-3(4H)-one, 6-amino-2,2-dimethyl-

CAS: 1002726-62-6

Formula: C₉H₁₁N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 193.2025

Ref: IN-DA0001FG

6-Amino-2,2-dimethyl-2H,3H,4H-pyrido[3,2-b][1,4]oxazin-3-one

CAS: 1002726-62-6

6-Amino-2,2-dimethyl-2H,3H,4H-pyrido[3,2-b][1,4]oxazin-3-one

Purity: 95%

Molecular weight: 193.20g/mol

Ref: 54-OR75472

6-Amino-2,2-dimethyl-2H-pyrido[3,2-b] [1,4]oxazin-3[4H]-one

CAS: 1002726-62-6

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 193.20599365234375

Ref: 10-F219314