CymitQuimica logo

CAS 100276-37-7

:

6,8-Difluoro-1,4-dihydro-1-(methylamino)-7-(4-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid

Description:
6,8-Difluoro-1,4-dihydro-1-(methylamino)-7-(4-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid is a synthetic compound belonging to the class of quinolone derivatives, which are known for their diverse biological activities, particularly as antibacterial agents. This compound features a quinoline core, characterized by a bicyclic structure that includes a nitrogen atom, contributing to its pharmacological properties. The presence of difluoro substituents at the 6 and 8 positions enhances its lipophilicity and may influence its interaction with biological targets. The methylamino group at the 1-position and the 4-methyl-1-piperazinyl moiety at the 7-position suggest potential for enhanced receptor binding and activity. Additionally, the carboxylic acid functional group is crucial for solubility and may play a role in the compound's mechanism of action. Overall, this compound's unique structural features contribute to its potential therapeutic applications, particularly in the field of infectious diseases. However, specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C16H18F2N4O3
InChI:InChI=1S/C16H18F2N4O3/c1-19-22-8-10(16(24)25)15(23)9-7-11(17)14(12(18)13(9)22)21-5-3-20(2)4-6-21/h7-8,19H,3-6H2,1-2H3,(H,24,25)
InChI key:InChIKey=ADFVPAPYAFZEQX-UHFFFAOYSA-N
SMILES:N(C)N1C=2C(C(=O)C(C(O)=O)=C1)=CC(F)=C(C2F)N3CCN(C)CC3
Synonyms:
  • 3-Quinolinecarboxylic acid, 6,8-difluoro-1,4-dihydro-1-(methylamino)-7-(4-methyl-1-piperazinyl)-4-oxo-
  • 6,8-Difluoro-1,4-dihydro-1-(methylamino)-7-(4-methyl-1-piperazinyl)-4-oxo-3-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.