CymitQuimica logo

CAS 100289-14-3

:

ethyl 5-acetyl-4-methylthiazole-2-carboxylate

Description:
Ethyl 5-acetyl-4-methylthiazole-2-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its solubility in organic solvents. The presence of the acetyl and methyl groups on the thiazole ring enhances its reactivity and may influence its biological activity. Typically, compounds like this can exhibit various properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals and agrochemicals. The thiazole moiety is often associated with diverse biological activities, including antimicrobial and antifungal properties. Additionally, the compound's structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, making it a valuable building block in synthetic chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H11NO3S
InChI:InChI=1S/C9H11NO3S/c1-4-13-9(12)8-10-5(2)7(14-8)6(3)11/h4H2,1-3H3
InChI key:BHIPQSKRMASYBP-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NC(=C(S1)C(=O)C)C
Synonyms:
  • 2-Thiazolecarboxylic acid, 5-acetyl-4-methyl-, ethyl ester
  • ethyl 5-acetyl-4-methylthiazole-2-carboxylate
Found 3 products.