CymitQuimica logo

CAS 100289-17-6

:

1-(2-Amino-4-methyl-5-thiazolyl)-1-propanone

Description:
1-(2-Amino-4-methyl-5-thiazolyl)-1-propanone, with the CAS number 100289-17-6, is an organic compound characterized by its thiazole ring, which contributes to its biological activity. This substance features an amino group and a ketone functional group, indicating potential reactivity and interaction with various biological systems. The presence of the thiazole moiety suggests that it may exhibit antimicrobial or antifungal properties, as thiazole derivatives are often associated with such activities. Additionally, the methyl group on the thiazole ring can influence the compound's lipophilicity and solubility, affecting its pharmacokinetic properties. The compound's structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be assessed under various conditions to determine its suitability for further research or application. Overall, this compound represents a class of molecules with significant potential in drug discovery and development.
Formula:C7H10N2OS
InChI:InChI=1S/C7H10N2OS/c1-3-5(10)6-4(2)9-7(8)11-6/h3H2,1-2H3,(H2,8,9)
InChI key:InChIKey=QPBFJPKBHNPSRU-UHFFFAOYSA-N
SMILES:C(CC)(=O)C=1SC(N)=NC1C
Synonyms:
  • 1-Propanone, 1-(2-amino-4-methyl-5-thiazolyl)-
  • 1-(2-Amino-4-methyl-5-thiazolyl)-1-propanone
  • 1-(2-amino-4-methyl-1,3-thiazol-5-yl)propan-1-one
  • 1-(2-Amino-4-methyl-thiazol-5-yl)-propan-1-one
Found 2 products.