CAS 10029-09-1
:cis-1,4-Cyclohexanedimethanamine
Description:
Cis-1,4-Cyclohexanedimethanamine, with the CAS number 10029-09-1, is an organic compound characterized by its cyclohexane ring structure featuring two amine functional groups. This compound is a type of diamine, specifically a cyclohexanediamine, where the amine groups are positioned at the 1 and 4 carbon atoms of the cyclohexane ring in a cis configuration. This configuration influences its physical and chemical properties, such as its reactivity and solubility. Typically, cis-1,4-Cyclohexanedimethanamine is a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its potential applications in the synthesis of polyamides and as a curing agent in epoxy resins. The presence of amine groups allows for hydrogen bonding, which can affect its boiling point and solubility in various solvents. Additionally, it may exhibit moderate toxicity, necessitating appropriate safety measures during handling and use. Overall, its unique structure and functional groups make it a valuable compound in organic synthesis and materials science.
Formula:C8H18N2
InChI:InChI=1/C8H18N2/c9-5-7-1-2-8(6-10)4-3-7/h7-8H,1-6,9-10H2/t7-,8+
InChI key:InChIKey=OXIKYYJDTWKERT-OCAPTIKFNA-N
SMILES:C(N)[C@H]1CC[C@@H](CN)CC1
Synonyms:- cis-1,4-Cyclohexanebis(methylamine)
- cis-1,4-Bis(aminomethyl)cyclohexane
- cis-1,4-Cyclohexanedimethanamine
- 1,4-Cyclohexanedimethanamine, cis-
- 1,4-Cyclohexanebis(methylamine), cis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
cis-1,4-Bis(aminomethyl)cyclohexane
CAS:cis-1,4-Bis(aminomethyl)cyclohexaneFormula:C8H18N2Purity:>98.0%Molecular weight:142.251,4-Cyclohexanedimethanamine, cis-
CAS:Formula:C8H18N2Purity:98.0%Color and Shape:LiquidMolecular weight:142.2419cis-1,4-Bis(aminomethyl)cyclohexane
CAS:Formula:C8H18N2Purity:>98.0%(GC)(T)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:142.25cis-1,4-Bis(aminomethyl)cyclohexane
CAS:cis-1,4-Bis(aminomethyl)cyclohexane is a cycloaliphatic compound that can be used as an intermediate for the synthesis of terephthalic acid. It has been shown to reduce blood pressure in women, and may have anticancer effects. cis-1,4-Bis(aminomethyl)cyclohexane is prepared by reacting alkali metal with this compound in water or ethanol. The reaction system is gas chromatographic analysis, which separates cis-1,4-Bis(aminomethyl)cyclohexane from its isomers on the basis of their different boiling points. cis-1,4-Bis(aminomethyl)cyclohexane can also react with hydrogen to produce trans-1,4-bis(aminomethyl)cyclohexane and amide.
Formula:C8H18N2Purity:Min. 95%Molecular weight:142.25 g/mol



