CAS 1003-98-1: 2-bromo-4-fluoroaniline

Description:2-Bromo-4-fluoroaniline is an organic compound characterized by the presence of both bromine and fluorine substituents on an aniline structure. It features a benzene ring with an amino group (-NH2) attached, which is a key functional group that imparts basic properties to the molecule. The bromine atom is located at the second position, while the fluorine atom is at the fourth position relative to the amino group. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions. The presence of halogens like bromine and fluorine can influence the compound's reactivity, solubility, and overall stability. Additionally, 2-bromo-4-fluoroaniline may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization in laboratory settings.

Formula:C₆H₅BrFN

InChI:InChI=1/C6H5BrFN/c7-5-2-1-4(8)3-6(5)9/h1-3H,9H2

Synonyms:
Bromofluoroaniline1
4-Fluoro-2-Bromoaniline
2-Bromo-4-Fluoro-Phenylamine
2-Bromo-4-fluoroaniline 99%
2-Bromo-4-fluoroaniline99%
2-Bromo-4-Fluoroaniline 98+%
Benzenamine, 2-bromo-4-fluoro-

Found 6 products.

Product data	Purity	Price range	Estimated delivery
2-Bromo-4-fluoroaniline REF: 3B-B1829CAS: 1003-98-1	>98.0%(GC)	36.00 €~92.00 €	Mon 24 Feb 25
2-Bromo-4-fluoroaniline, 98% REF: 02-A11751CAS: 1003-98-1	98%	To inquire	Tue 25 Feb 25
Benzenamine, 2-bromo-4-fluoro- REF: IN-DA0001J9CAS: 1003-98-1	98%	24.00 €~243.00 €	Mon 03 Mar 25
2-Bromo-4-fluoroaniline REF: 54-PC1397CAS: 1003-98-1	99%	56.00 €	Tue 04 Mar 25
2-Bromo-4-fluoroaniline REF: 10-F003144CAS: 1003-98-1	97.0%	20.00 €~285.00 €	Tue 04 Mar 25
2-Bromo-4-fluoroaniline REF: 3D-FB64305CAS: 1003-98-1	Min. 95%	- - -	Discontinued product