CAS 1003-98-1
:2-bromo-4-fluoroaniline
Description:
2-Bromo-4-fluoroaniline is an organic compound characterized by the presence of both bromine and fluorine substituents on an aniline structure. It features a benzene ring with an amino group (-NH2) attached, which is a key functional group that imparts basic properties to the molecule. The bromine atom is located at the second position, while the fluorine atom is at the fourth position relative to the amino group. This compound is typically a solid at room temperature and is known for its potential applications in pharmaceuticals and agrochemicals due to its reactivity and ability to participate in various chemical reactions, such as nucleophilic substitutions. The presence of halogens like bromine and fluorine can influence the compound's reactivity, solubility, and overall stability. Additionally, 2-bromo-4-fluoroaniline may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization in laboratory settings.
Formula:C6H5BrFN
InChI:InChI=1/C6H5BrFN/c7-5-2-1-4(8)3-6(5)9/h1-3H,9H2
SMILES:c1cc(c(cc1F)N)Br
Synonyms:- Bromofluoroaniline1
- 4-Fluoro-2-Bromoaniline
- 2-Bromo-4-Fluoro-Phenylamine
- 2-Bromo-4-fluoroaniline 99%
- 2-Bromo-4-fluoroaniline99%
- 2-Bromo-4-Fluoroaniline 98+%
- Benzenamine, 2-bromo-4-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Bromo-4-fluoroaniline, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H5BrFNPurity:98%Color and Shape:Liquid as melt, Clear pale yellow or orange-pink to brownMolecular weight:190.022-Bromo-4-fluoroaniline
CAS:2-Bromo-4-fluoroanilineFormula:C6H5BrFNPurity:99%Color and Shape:Pale yellow Solid-Low MeltMolecular weight:190.013Benzenamine, 2-bromo-4-fluoro-
CAS:Formula:C6H5BrFNPurity:98%Color and Shape:LiquidMolecular weight:190.01302-Bromo-4-fluoroaniline
CAS:Formula:C6H5BrFNPurity:>98.0%(GC)Color and Shape:White or Colorless to Brown powder to lump to clear liquidMolecular weight:190.022-Bromo-4-fluoroaniline
CAS:Formula:C6H5BrFNPurity:97%Color and Shape:Liquid, ClearMolecular weight:190.015





