CAS 10030-80-5: L-Mannose
Description:L-Mannose is a naturally occurring monosaccharide, specifically an aldohexose, that plays a crucial role in various biological processes. It is an epimer of D-glucose, differing in the configuration around one specific carbon atom. L-Mannose is typically found in fruits, vegetables, and certain polysaccharides, and it is particularly abundant in the mannans of plant cell walls. This sugar is known for its role in glycoprotein synthesis and is involved in cellular recognition processes. L-Mannose is often utilized in dietary supplements, particularly for urinary tract health, as it may help prevent the adhesion of certain bacteria to the urinary tract lining. In terms of physical properties, L-Mannose is a white crystalline powder that is soluble in water, making it easy to incorporate into various formulations. Its sweet taste is less intense than that of sucrose. Additionally, L-Mannose is generally recognized as safe for consumption, although individuals with certain metabolic disorders should consult healthcare professionals before use.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5-,6-/m0/s1
InChI key:InChIKey=GZCGUPFRVQAUEE-BXKVDMCESA-N
SMILES:O=CC(O)C(O)C(O)C(O)CO
- Synonyms:
- <span class="text-smallcaps">L</span>-Mannose
- Hexopyranose
- L-mannopyranose
- Mannose, <span class="text-smallcaps">L</span>-
- alpha-L-mannopyranose
- beta-L-mannopyranose
- Mannose, L-
- L-Mannose