CymitQuimica logo

CAS 1003011-02-6

:

tert-butyl 5-amino-1H-pyrazole-1-carboxylate

Description:
Tert-butyl 5-amino-1H-pyrazole-1-carboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two adjacent nitrogen atoms. This substance features a tert-butyl group, which enhances its lipophilicity and steric bulk, making it useful in various chemical applications. The presence of the amino group at the 5-position of the pyrazole ring contributes to its potential reactivity and ability to form hydrogen bonds, while the carboxylate moiety indicates that it can participate in acid-base reactions. This compound is often utilized in medicinal chemistry and drug development due to its biological activity and ability to act as a building block for more complex molecules. Its solubility properties are influenced by the tert-butyl group and the carboxylate functionality, making it suitable for various solvent systems. Overall, tert-butyl 5-amino-1H-pyrazole-1-carboxylate is a versatile compound with significant implications in synthetic organic chemistry and pharmacology.
Formula:C8H13N3O2
InChI:InChI=1S/C8H13N3O2/c1-8(2,3)13-7(12)11-6(9)4-5-10-11/h4-5H,9H2,1-3H3
InChI key:QYQBAJXCDXDNJU-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C(=CC=N1)N
Found 5 products.