CymitQuimica logo

CAS 1003013-76-0

:

3-((benzyloxy)methyl)oxetane

Description:
3-((Benzyloxy)methyl)oxetane is a chemical compound characterized by its oxetane ring, which is a four-membered cyclic ether. The presence of a benzyloxy group indicates that a benzyl group is attached to the oxygen atom of the oxetane, contributing to its reactivity and solubility properties. This compound typically exhibits a moderate polarity due to the combination of the hydrophobic benzyl group and the polar ether functionality. It may participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions, making it useful in organic synthesis and as an intermediate in the production of more complex molecules. The compound's structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, its unique properties may be leveraged in the development of novel polymers or as a building block in the synthesis of biologically active compounds. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-2-4-10(5-3-1)6-12-7-11-8-13-9-11/h1-5,11H,6-9H2
InChI key:KUTKSFHVQSBUNA-UHFFFAOYSA-N
SMILES:C1C(CO1)COCC2=CC=CC=C2
Synonyms:
  • 5-(Methanesulfonyl)ethylsuccinimidyl
  • 3-((benzyloxy)methyl)oxetane
  • Oxetane, 3-[(phenylmethoxy)methyl]-
Found 3 products.