CymitQuimica logo

CAS 1003013-83-9

:

Cyclobutane, 3-(iodomethyl)-1,1-dimethoxy-

Description:
Cyclobutane, 3-(iodomethyl)-1,1-dimethoxy- is an organic compound characterized by its cyclobutane ring structure, which consists of four carbon atoms arranged in a cyclic formation. The presence of the iodomethyl group indicates that an iodine atom is attached to a carbon atom in the cyclobutane ring, contributing to its reactivity and potential applications in organic synthesis. The two methoxy groups (-OCH3) suggest that the compound has ether functionalities, which can influence its solubility and polarity. This compound is likely to exhibit moderate volatility and may participate in various chemical reactions, such as nucleophilic substitutions or eliminations, due to the presence of the iodine atom. Its unique structure may also impart specific physical properties, such as melting and boiling points, which are influenced by the steric and electronic effects of the substituents. Overall, Cyclobutane, 3-(iodomethyl)-1,1-dimethoxy- is a versatile compound with potential applications in medicinal chemistry and materials science.
Formula:C7H13IO2
InChI:InChI=1S/C7H13IO2/c1-9-7(10-2)3-6(4-7)5-8/h6H,3-5H2,1-2H3
InChI key:AGPKIHFLRJRIKP-UHFFFAOYSA-N
SMILES:COC1(CC(C1)CI)OC
Synonyms:
  • 3-Iodomethyl-1,1-dimethoxycyclobutane
Found 2 products.