CymitQuimica logo

CAS 1003043-37-5

:

B-[2-Chloro-6-(1-methylethyl)-3-pyridinyl]boronic acid

Description:
B-[2-Chloro-6-(1-methylethyl)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a pyridine ring substituted with a chlorine atom and an isopropyl group, contributing to its unique reactivity and potential biological activity. Boronic acids are typically polar and can exhibit moderate solubility in water, depending on their substituents. This particular compound may be utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, which is a key method for forming carbon-carbon bonds in the synthesis of pharmaceuticals and agrochemicals. Additionally, the presence of the chlorine atom may influence its electronic properties and reactivity, while the boronic acid moiety can participate in various coordination chemistry applications. Overall, B-[2-Chloro-6-(1-methylethyl)-3-pyridinyl]boronic acid is a versatile compound with significant implications in chemical research and development.
Formula:C8H11BClNO2
InChI:InChI=1S/C8H11BClNO2/c1-5(2)7-4-3-6(9(12)13)8(10)11-7/h3-5,12-13H,1-2H3
InChI key:InChIKey=FBLHWIQSYHMHSK-UHFFFAOYSA-N
SMILES:C(C)(C)C=1N=C(Cl)C(B(O)O)=CC1
Synonyms:
  • Boronic acid, B-[2-chloro-6-(1-methylethyl)-3-pyridinyl]-
  • B-[2-Chloro-6-(1-methylethyl)-3-pyridinyl]boronic acid
  • [2-Chloro-6-(propan-2-yl)pyridin-3-yl]boronic acid
  • 2-Chloro-6-isopropylpyridine-3-boronic acid
Found 3 products.