CymitQuimica logo

CAS 1003043-67-1

:

B-[6-(1-Piperazinyl)-3-pyridinyl]boronic acid

Description:
B-[6-(1-Piperazinyl)-3-pyridinyl]boronic acid is an organic compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a piperazine moiety, contributing to its potential biological activity and solubility properties. The boronic acid group enhances its utility in medicinal chemistry, particularly in drug design and development, as it can participate in various chemical reactions, including Suzuki coupling, which is pivotal in synthesizing complex organic molecules. Additionally, the presence of nitrogen atoms in both the piperazine and pyridine rings may influence its pharmacokinetic properties, such as permeability and binding affinity to biological targets. Overall, B-[6-(1-Piperazinyl)-3-pyridinyl]boronic acid is a versatile compound with applications in pharmaceuticals and materials science, particularly in the development of targeted therapies and molecular probes.
Formula:C9H14BN3O2
InChI:InChI=1S/C9H14BN3O2/c14-10(15)8-1-2-9(12-7-8)13-5-3-11-4-6-13/h1-2,7,11,14-15H,3-6H2
InChI key:InChIKey=JICCVPKLABRNMW-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(N=C1)N2CCNCC2
Synonyms:
  • Boronic acid, B-[6-(1-piperazinyl)-3-pyridinyl]-
  • (6-(Piperazin-1-yl)pyridin-3-yl)boronic acid
  • B-[6-(1-Piperazinyl)-3-pyridinyl]boronic acid
Found 4 products.