CymitQuimica logo

CAS 1003043-76-2

:

6-Bromo-4-chloro-2-(methylthio)quinazoline

Description:
6-Bromo-4-chloro-2-(methylthio)quinazoline is a heterocyclic organic compound characterized by its quinazoline backbone, which consists of a fused benzene and pyrimidine ring. The presence of bromine and chlorine substituents at the 6 and 4 positions, respectively, contributes to its reactivity and potential biological activity. The methylthio group at the 2-position enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically used in medicinal chemistry and drug development due to its potential pharmacological properties, including anticancer and antimicrobial activities. Its molecular structure allows for various chemical modifications, making it a versatile scaffold in synthetic organic chemistry. Additionally, the presence of halogens can facilitate further reactions, such as nucleophilic substitutions or coupling reactions. As with many quinazoline derivatives, it may exhibit a range of biological activities, making it of interest in the fields of pharmacology and biochemistry. Proper handling and safety measures should be observed due to the presence of halogenated compounds, which can pose health risks.
Formula:C9H6BrClN2S
InChI:InChI=1S/C9H6BrClN2S/c1-14-9-12-7-3-2-5(10)4-6(7)8(11)13-9/h2-4H,1H3
InChI key:InChIKey=JVOCVKFAENOWJO-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(SC)N1)C=CC(Br)=C2
Synonyms:
  • Quinazoline, 6-bromo-4-chloro-2-(methylthio)-
  • 6-Bromo-4-chloro-2-(methylthio)quinazoline
  • 6-Bromo-4-chloro-2-(methylsulfanyl)quinazoline
Found 2 products.