CymitQuimica logo

CAS 100305-91-7

:

1,2,3-Thiadiazole-4-carboxaldehyde, 5-chloro-

Description:
1,2,3-Thiadiazole-4-carboxaldehyde, 5-chloro- is a heterocyclic organic compound characterized by a five-membered ring containing two nitrogen atoms and one sulfur atom, along with a carboxaldehyde functional group and a chlorine substituent. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. The presence of the thiadiazole ring imparts unique chemical reactivity, making it a potential candidate for various applications in pharmaceuticals and agrochemicals. The aldehyde group allows for further functionalization, enabling the synthesis of more complex molecules. Additionally, the chlorine atom can influence the compound's biological activity and stability. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other substituents. Overall, 1,2,3-Thiadiazole-4-carboxaldehyde, 5-chloro- is of interest in synthetic chemistry and material science due to its versatile reactivity and potential applications.
Formula:C3HClN2OS
InChI:InChI=1S/C3HClN2OS/c4-3-2(1-7)5-6-8-3/h1H
InChI key:TUKGSBUMIWKUCY-UHFFFAOYSA-N
SMILES:C(=O)C1=C(SN=N1)Cl
Found 2 products.