CymitQuimica logo

CAS 100305-95-1

:

Benzenamine, 2-methyl-6-(methylthio)-

Description:
Benzenamine, 2-methyl-6-(methylthio)-, also known as 2-methyl-6-(methylthio)aniline, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with an amino group (-NH2), a methyl group (-CH3), and a methylthio group (-S-CH3). This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the amino group. The methylthio substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, benzenamines are known for their applications in the synthesis of dyes, pharmaceuticals, and agrochemicals. Safety considerations should be taken into account, as aromatic amines can pose health risks, including potential carcinogenic effects. Proper handling and storage in a well-ventilated area are essential to minimize exposure.
Formula:C8H11NS
InChI:InChI=1S/C8H11NS/c1-6-4-3-5-7(10-2)8(6)9/h3-5H,9H2,1-2H3
InChI key:OBTJYVQYCJYACZ-UHFFFAOYSA-N
SMILES:CC1=C(C(=CC=C1)SC)N
Found 4 products.