CAS 100306-34-1
:(-)-3-Chloro-1-phenyl-1-propanol
Description:
(-)-3-Chloro-1-phenyl-1-propanol is an organic compound characterized by its chiral nature, featuring a chlorine atom and a phenyl group attached to a propanol backbone. This compound typically exists as a colorless to pale yellow liquid and is known for its moderate solubility in water, which is influenced by the presence of the hydroxyl (-OH) group. The chlorine substituent contributes to its reactivity, making it a potential intermediate in various organic synthesis reactions. The presence of the phenyl group enhances its hydrophobic characteristics, affecting its interaction with biological systems and solvents. As a chiral molecule, it can exhibit different biological activities depending on its stereochemistry, which is crucial in pharmaceutical applications. Safety data indicates that it should be handled with care, as it may pose risks if ingested or inhaled. Overall, (-)-3-Chloro-1-phenyl-1-propanol is significant in synthetic organic chemistry and may have applications in the development of pharmaceuticals and agrochemicals.
Formula:C9H11ClO
InChI:InChI=1S/C9H11ClO/c10-7-6-9(11)8-4-2-1-3-5-8/h1-5,9,11H,6-7H2/t9-/m0/s1
InChI key:InChIKey=JZFUHAGLMZWKTF-VIFPVBQESA-N
SMILES:[C@@H](CCCl)(O)C1=CC=CC=C1
Synonyms:- (-)-3-Chloro-1-phenyl-1-propanol
- (1S)-3-chloro-1-phenylpropan-1-ol
- (S)-(-)-1-Phenyl-3-chloro-1-propanol
- (S)-3-Chloro-1-phenyl-propanol
- (αS)-α-(2-Chloroethyl)benzenemethanol
- Benzenemethanol, α-(2-chloroethyl)-, (S)-
- Benzenemethanol, α-(2-chloroethyl)-, (αS)-
- (S)-(-)-3-Chloro-1-phenyl-1-propanol
- (S)-(?-3-Chloro-1-phenyl-1-propanol
- (S)-3-Chloro-1-phenyl-1-propanol
- (S)-3-Chloro-1-phenyl-1-propanol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(S)-(-)-3-Chloro-1-phenyl-1-propanol
CAS:Formula:C9H11ClOPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:170.64Benzenemethanol, α-(2-chloroethyl)-, (αS)-
CAS:Formula:C9H11ClOPurity:95%Color and Shape:SolidMolecular weight:170.6360(1S)-3-Chloro-1-phenylpropan-1-ol
CAS:(1S)-3-Chloro-1-phenylpropan-1-olFormula:C9H11ClOPurity:97%Color and Shape:SolidMolecular weight:170.63603(S)-(-)-3-Chloro-1-phenyl-1-propanol (>90%)
CAS:Controlled ProductApplications (S)-(-)-3-Chloro-1-phenyl-1-propanol (cas# 100306-34-1) is a compound useful in organic synthesis.
Formula:C9H11ClOPurity:>90%Color and Shape:NeatMolecular weight:170.64(S)-3-Chloro-1-phenylpropan-1-ol
CAS:(S)-3-Chloro-1-phenylpropan-1-olFormula:C9H11ClOPurity:95%Molecular weight:170.64(S)-3-Chloro-1-phenylpropan-1-ol
CAS:Formula:C9H11ClOPurity:98%Color and Shape:Solid, Crystalline Powder or Fibers or PowderMolecular weight:170.64(S)-(-)-3-Chloro-1-phenyl-1-propanol
CAS:(S)-(-)-3-Chloro-1-phenyl-1-propanol is an efficient method for the synthesis of chiral propiophenone. It is synthesized by reacting a mixture of borane and tetrahydrofuran with (S)-(-)-3-chloro-1-phenylpropanol. This reaction produces the desired compound in good yield and high diastereoselectivity. The synthesis of this compound has been shown to be useful for the production of antidepressant drugs, such as κ-opioid receptor ligands, which are used to treat depression, anxiety, and chronic pain.
Formula:C9H11ClOPurity:Min. 95%Molecular weight:170.64 g/mol






