CymitQuimica logo

CAS 100313-48-2

:

5,6-dihydro-2H-pyran-3-carboxylic acid

Description:
5,6-Dihydro-2H-pyran-3-carboxylic acid is a heterocyclic organic compound characterized by its pyran ring structure, which features a six-membered ring containing one oxygen atom and five carbon atoms. The compound has a carboxylic acid functional group (-COOH) at the 3-position, contributing to its acidic properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents such as water and alcohols, which is common for carboxylic acids. The presence of the dihydro group indicates that it has two additional hydrogen atoms compared to its fully unsaturated counterpart, affecting its reactivity and stability. 5,6-Dihydro-2H-pyran-3-carboxylic acid can participate in various chemical reactions, including esterification and amidation, making it useful in organic synthesis and potentially in pharmaceutical applications. Its unique structure and functional groups allow for diverse reactivity, which can be exploited in the development of new materials or biologically active compounds.
Formula:C6H8O3
InChI:InChI=1/C6H8O3/c7-6(8)5-2-1-3-9-4-5/h2H,1,3-4H2,(H,7,8)
InChI key:KZYJYFKCCFWQQU-UHFFFAOYSA-N
SMILES:C1C=C(COC1)C(=O)O
Synonyms:
  • 2H-Pyran-3-carboxylic acid, 5,6-dihydro-
  • 5,6-Dihydro-2H-pyran-3-carboxylic acid
Found 2 products.